C30H19Cl2N7S2 — CID 101271304
(2Z)-2-(1,3-benzothiazol-2-yl)-2-[(4Z,5E)-4,5-bis[(4-chlorophenyl)hydrazinylidene]-3-phenyl-1,3-thiazolidin-2-ylidene]acetonitrile (PubChem CID 101271304) has the molecular formula C30H19Cl2N7S2 and a molecular weight of 612.57 g/mol. Its IUPAC name is (2Z)-2-(1,3-benzothiazol-2-yl)-2-[(4Z,5E)-4,5-bis[(4-chlorophenyl)hydrazinylidene]-3-phenyl-1,3-thiazolidin-2-ylidene]acetonitrile.
| Compound Name | (2Z)-2-(1,3-benzothiazol-2-yl)-2-[(4Z,5E)-4,5-bis[(4-chlorophenyl)hydrazinylidene]-3-phenyl-1,3-thiazolidin-2-ylidene]acetonitrile |
|---|---|
| PubChem CID | 101271304 |
| Molecular Formula | C30H19Cl2N7S2 |
| Molecular Weight | 612.57 g/mol |
| Exact Mass | 611.05 |
| IUPAC Name | (2Z)-2-(1,3-benzothiazol-2-yl)-2-[(4Z,5E)-4,5-bis[(4-chlorophenyl)hydrazinylidene]-3-phenyl-1,3-thiazolidin-2-ylidene]acetonitrile |
| SMILES | N#C/C(=C1/SC(=N/Nc2ccc(Cl)cc2)/C(=N/Nc2ccc(Cl)cc2)N1c1ccccc1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C30H19Cl2N7S2/c31-19-10-14-21(15-11-19)35-37-27-29(38-36-22-16-12-20(32)13-17-22)41-30(39(27)23-6-2-1-3-7-23)24(18-33)28-34-25-8-4-5-9-26(25)40-28/h1-17,35-36H/b30-24-,37-27-,38-29+ |
| InChIKey | CEIMAMQNLIZZSM-FGFYNSIDSA-N |
| XLogP | 8.90 |
| TPSA | 88.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.57 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|