C22H40O10SSi — CID 101272556
ethyl 5-[(4S,5R)-5-[(R)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxo-1,3,2-dioxathiolane-4-carboxylate (PubChem CID 101272556) has the molecular formula C22H40O10SSi and a molecular weight of 524.71 g/mol. Its IUPAC name is ethyl 5-[(4S,5R)-5-[(R)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxo-1,3,2-dioxathiolane-4-carboxylate.
| Compound Name | ethyl 5-[(4S,5R)-5-[(R)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxo-1,3,2-dioxathiolane-4-carboxylate |
|---|---|
| PubChem CID | 101272556 |
| Molecular Formula | C22H40O10SSi |
| Molecular Weight | 524.71 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | ethyl 5-[(4S,5R)-5-[(R)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxo-1,3,2-dioxathiolane-4-carboxylate |
| SMILES | CCOC(=O)C1OS(=O)OC1[C@H]1OC(C)(C)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C22H40O10SSi/c1-11-25-19(23)18-17(30-33(24)31-18)16-15(28-22(7,8)29-16)14(13-12-26-21(5,6)27-13)32-34(9,10)20(2,3)4/h13-18H,11-12H2,1-10H3/t13-,14-,15+,16+,17?,18?,33?/m1/s1 |
| InChIKey | WOOBHSRGHUXBOS-DNKYVCOSSA-N |
| XLogP | 2.97 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.71 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|