C29H60O8Si3 — CID 10348936
(3R,4S,5S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(R)-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]oxolan-2-one (PubChem CID 10348936) has the molecular formula C29H60O8Si3 and a molecular weight of 621.05 g/mol. Its IUPAC name is (3R,4S,5S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(R)-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]oxolan-2-one.
| Compound Name | (3R,4S,5S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(R)-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]oxolan-2-one |
|---|---|
| PubChem CID | 10348936 |
| Molecular Formula | C29H60O8Si3 |
| Molecular Weight | 621.05 g/mol |
| Exact Mass | 620.36 |
| IUPAC Name | (3R,4S,5S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(R)-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]oxolan-2-one |
| SMILES | CC1(C)O[C@@H]([C@@H](O)[C@@H]2OC(=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C29H60O8Si3/c1-26(2,3)38(12,13)32-18-19-21(35-29(10,11)34-19)20(30)22-23(36-39(14,15)27(4,5)6)24(25(31)33-22)37-40(16,17)28(7,8)9/h19-24,30H,18H2,1-17H3/t19-,20+,21+,22-,23-,24+/m0/s1 |
| InChIKey | NLUFQIBBILFOMW-KAGYXSEVSA-N |
| XLogP | 6.60 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.05 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|