About CID 101344537
CID 101344537 (PubChem CID 101344537) has the molecular formula C11H12
and a molecular weight of 144.22 g/mol.
Molecular Properties
| Compound Name | CID 101344537 |
| PubChem CID | 101344537 |
| Molecular Formula | C11H12 |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | — |
| SMILES | [C]1CCC1Cc1ccccc1 |
| InChI | InChI=1S/C11H12/c1-2-5-10(6-3-1)9-11-7-4-8-11/h1-3,5-6,11H,4,7,9H2 |
| InChIKey | OFPHXBTUSVAJDQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 101344537 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 101344537?
The IUPAC name of CID 101344537 (CID 101344537) is not available.
What is the SMILES notation for CID 101344537?
The canonical SMILES for CID 101344537 is [C]1CCC1Cc1ccccc1.
What is the InChIKey of CID 101344537?
The InChIKey is OFPHXBTUSVAJDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12/c1-2-5-10(6-3-1)9-11-7-4-8-11/h1-3,5-6,11H,4,7,9H2.
What are the key properties of CID 101344537?
CID 101344537 has a molecular weight of 144.22 g/mol, XLogP of 2.72, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 101344537 is sourced from PubChem (CID 101344537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).