C19H20ClNO5S — CID 101363021
methyl (4aS,8aR)-1-(3-chlorophenyl)sulfonyl-6,7-dimethyl-2-oxo-8,8a-dihydro-5H-quinoline-4a-carboxylate (PubChem CID 101363021) has the molecular formula C19H20ClNO5S and a molecular weight of 409.89 g/mol. Its IUPAC name is methyl (4aS,8aR)-1-(3-chlorophenyl)sulfonyl-6,7-dimethyl-2-oxo-8,8a-dihydro-5H-quinoline-4a-carboxylate.
| Compound Name | methyl (4aS,8aR)-1-(3-chlorophenyl)sulfonyl-6,7-dimethyl-2-oxo-8,8a-dihydro-5H-quinoline-4a-carboxylate |
|---|---|
| PubChem CID | 101363021 |
| Molecular Formula | C19H20ClNO5S |
| Molecular Weight | 409.89 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | methyl (4aS,8aR)-1-(3-chlorophenyl)sulfonyl-6,7-dimethyl-2-oxo-8,8a-dihydro-5H-quinoline-4a-carboxylate |
| SMILES | COC(=O)[C@@]12C=CC(=O)N(S(=O)(=O)c3cccc(Cl)c3)[C@@H]1CC(C)=C(C)C2 |
| InChI | InChI=1S/C19H20ClNO5S/c1-12-9-16-19(11-13(12)2,18(23)26-3)8-7-17(22)21(16)27(24,25)15-6-4-5-14(20)10-15/h4-8,10,16H,9,11H2,1-3H3/t16-,19-/m1/s1 |
| InChIKey | MNYPRUHVHFESPK-VQIMIIECSA-N |
| XLogP | 3.09 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.89 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|