C6H8N6 — CID 101364025
(3R,4S)-3,4-diazidocyclohexene (PubChem CID 101364025) has the molecular formula C6H8N6 and a molecular weight of 164.17 g/mol. Its IUPAC name is (3R,4S)-3,4-diazidocyclohexene.
| Compound Name | (3R,4S)-3,4-diazidocyclohexene |
|---|---|
| PubChem CID | 101364025 |
| Molecular Formula | C6H8N6 |
| Molecular Weight | 164.17 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | (3R,4S)-3,4-diazidocyclohexene |
| SMILES | [N-]=[N+]=N[C@H]1CCC=C[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C6H8N6/c7-11-9-5-3-1-2-4-6(5)10-12-8/h1,3,5-6H,2,4H2/t5-,6+/m1/s1 |
| InChIKey | OXTVQMCHYGDKKB-RITPCOANSA-N |
| XLogP | 2.69 |
| TPSA | 97.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.17 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|