C8H12IN9 — CID 102065572
(1S,2S,5S,6S)-1,2,5-triazido-6-iodocyclooctane (PubChem CID 102065572) has the molecular formula C8H12IN9 and a molecular weight of 361.15 g/mol. Its IUPAC name is (1S,2S,5S,6S)-1,2,5-triazido-6-iodocyclooctane.
| Compound Name | (1S,2S,5S,6S)-1,2,5-triazido-6-iodocyclooctane |
|---|---|
| PubChem CID | 102065572 |
| Molecular Formula | C8H12IN9 |
| Molecular Weight | 361.15 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | (1S,2S,5S,6S)-1,2,5-triazido-6-iodocyclooctane |
| SMILES | [N-]=[N+]=N[C@H]1CC[C@H](N=[N+]=[N-])[C@@H](I)CC[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C8H12IN9/c9-5-1-2-7(14-17-11)8(15-18-12)4-3-6(5)13-16-10/h5-8H,1-4H2/t5-,6-,7-,8-/m0/s1 |
| InChIKey | LXZCIZPMTZJHEB-XAMCCFCMSA-N |
| XLogP | 4.40 |
| TPSA | 146.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.15 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|