C24H33O5PS — CID 101372614
[(1R,2S)-2-phenylcyclohexyl] 2-di(propan-2-yloxy)phosphorylbenzenesulfinate (PubChem CID 101372614) has the molecular formula C24H33O5PS and a molecular weight of 464.56 g/mol. Its IUPAC name is [(1R,2S)-2-phenylcyclohexyl] 2-di(propan-2-yloxy)phosphorylbenzenesulfinate.
| Compound Name | [(1R,2S)-2-phenylcyclohexyl] 2-di(propan-2-yloxy)phosphorylbenzenesulfinate |
|---|---|
| PubChem CID | 101372614 |
| Molecular Formula | C24H33O5PS |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | [(1R,2S)-2-phenylcyclohexyl] 2-di(propan-2-yloxy)phosphorylbenzenesulfinate |
| SMILES | CC(C)OP(=O)(OC(C)C)c1ccccc1S(=O)O[C@@H]1CCCC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C24H33O5PS/c1-18(2)27-30(25,28-19(3)4)23-16-10-11-17-24(23)31(26)29-22-15-9-8-14-21(22)20-12-6-5-7-13-20/h5-7,10-13,16-19,21-22H,8-9,14-15H2,1-4H3/t21-,22+,31?/m0/s1 |
| InChIKey | JTHSALHNRGHJDK-PYYJZALNSA-N |
| XLogP | 6.12 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|