C37H46O5 — CID 101373124
(2R,4S,5R)-4-[(1E,3E,5S,6S,7R)-6-[(4-methoxyphenyl)methoxy]-3,5,7-trimethyl-8-phenylmethoxyocta-1,3-dienyl]-5-methyl-2-phenyl-1,3-dioxane (PubChem CID 101373124) has the molecular formula C37H46O5 and a molecular weight of 570.77 g/mol. Its IUPAC name is (2R,4S,5R)-4-[(1E,3E,5S,6S,7R)-6-[(4-methoxyphenyl)methoxy]-3,5,7-trimethyl-8-phenylmethoxyocta-1,3-dienyl]-5-methyl-2-phenyl-1,3-dioxane.
| Compound Name | (2R,4S,5R)-4-[(1E,3E,5S,6S,7R)-6-[(4-methoxyphenyl)methoxy]-3,5,7-trimethyl-8-phenylmethoxyocta-1,3-dienyl]-5-methyl-2-phenyl-1,3-dioxane |
|---|---|
| PubChem CID | 101373124 |
| Molecular Formula | C37H46O5 |
| Molecular Weight | 570.77 g/mol |
| Exact Mass | 570.33 |
| IUPAC Name | (2R,4S,5R)-4-[(1E,3E,5S,6S,7R)-6-[(4-methoxyphenyl)methoxy]-3,5,7-trimethyl-8-phenylmethoxyocta-1,3-dienyl]-5-methyl-2-phenyl-1,3-dioxane |
| SMILES | COc1ccc(CO[C@H]([C@H](C)COCc2ccccc2)[C@@H](C)/C=C(C)/C=C/[C@@H]2O[C@H](c3ccccc3)OC[C@H]2C)cc1 |
| InChI | InChI=1S/C37H46O5/c1-27(16-21-35-29(3)24-41-37(42-35)33-14-10-7-11-15-33)22-28(2)36(40-26-32-17-19-34(38-5)20-18-32)30(4)23-39-25-31-12-8-6-9-13-31/h6-22,28-30,35-37H,23-26H2,1-5H3/b21-16+,27-22+/t28-,29+,30+,35-,36-,37+/m0/s1 |
| InChIKey | PCJCCWFCEJWXOB-VORNURQRSA-N |
| XLogP | 8.32 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.77 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|