C29H38O4 — CID 101373104
(2S,3R,4S,5E,7E)-2,4,6-trimethyl-8-[(2R,4S,5R)-5-methyl-2-phenyl-1,3-dioxan-4-yl]-1-phenylmethoxyocta-5,7-dien-3-ol (PubChem CID 101373104) has the molecular formula C29H38O4 and a molecular weight of 450.62 g/mol. Its IUPAC name is (2S,3R,4S,5E,7E)-2,4,6-trimethyl-8-[(2R,4S,5R)-5-methyl-2-phenyl-1,3-dioxan-4-yl]-1-phenylmethoxyocta-5,7-dien-3-ol.
| Compound Name | (2S,3R,4S,5E,7E)-2,4,6-trimethyl-8-[(2R,4S,5R)-5-methyl-2-phenyl-1,3-dioxan-4-yl]-1-phenylmethoxyocta-5,7-dien-3-ol |
|---|---|
| PubChem CID | 101373104 |
| Molecular Formula | C29H38O4 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.28 |
| IUPAC Name | (2S,3R,4S,5E,7E)-2,4,6-trimethyl-8-[(2R,4S,5R)-5-methyl-2-phenyl-1,3-dioxan-4-yl]-1-phenylmethoxyocta-5,7-dien-3-ol |
| SMILES | CC(/C=C/[C@@H]1O[C@H](c2ccccc2)OC[C@H]1C)=C\[C@H](C)[C@@H](O)[C@@H](C)COCc1ccccc1 |
| InChI | InChI=1S/C29H38O4/c1-21(15-16-27-23(3)19-32-29(33-27)26-13-9-6-10-14-26)17-22(2)28(30)24(4)18-31-20-25-11-7-5-8-12-25/h5-17,22-24,27-30H,18-20H2,1-4H3/b16-15+,21-17+/t22-,23+,24-,27-,28+,29+/m0/s1 |
| InChIKey | CTAUDVWOYGSAMI-JXDUXZFVSA-N |
| XLogP | 6.09 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|