C22H34NO7P — CID 101379683
2-[3-[benzyl(2-diethoxyphosphorylethyl)amino]propanoyloxy]ethyl 2-methylprop-2-enoate (PubChem CID 101379683) has the molecular formula C22H34NO7P and a molecular weight of 455.49 g/mol. Its IUPAC name is 2-[3-[benzyl(2-diethoxyphosphorylethyl)amino]propanoyloxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[3-[benzyl(2-diethoxyphosphorylethyl)amino]propanoyloxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 101379683 |
| Molecular Formula | C22H34NO7P |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | 2-[3-[benzyl(2-diethoxyphosphorylethyl)amino]propanoyloxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)CCN(CCP(=O)(OCC)OCC)Cc1ccccc1 |
| InChI | InChI=1S/C22H34NO7P/c1-5-29-31(26,30-6-2)17-14-23(18-20-10-8-7-9-11-20)13-12-21(24)27-15-16-28-22(25)19(3)4/h7-11H,3,5-6,12-18H2,1-2,4H3 |
| InChIKey | GDLTWVQFGLPYBI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|