C18H26NO7P — CID 101379686
2-[benzyl-[3-[2-(2-methylprop-2-enoyloxy)ethoxy]-3-oxopropyl]amino]ethylphosphonic acid (PubChem CID 101379686) has the molecular formula C18H26NO7P and a molecular weight of 399.38 g/mol. Its IUPAC name is 2-[benzyl-[3-[2-(2-methylprop-2-enoyloxy)ethoxy]-3-oxopropyl]amino]ethylphosphonic acid.
| Compound Name | 2-[benzyl-[3-[2-(2-methylprop-2-enoyloxy)ethoxy]-3-oxopropyl]amino]ethylphosphonic acid |
|---|---|
| PubChem CID | 101379686 |
| Molecular Formula | C18H26NO7P |
| Molecular Weight | 399.38 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 2-[benzyl-[3-[2-(2-methylprop-2-enoyloxy)ethoxy]-3-oxopropyl]amino]ethylphosphonic acid |
| SMILES | C=C(C)C(=O)OCCOC(=O)CCN(CCP(=O)(O)O)Cc1ccccc1 |
| InChI | InChI=1S/C18H26NO7P/c1-15(2)18(21)26-12-11-25-17(20)8-9-19(10-13-27(22,23)24)14-16-6-4-3-5-7-16/h3-7H,1,8-14H2,2H3,(H2,22,23,24) |
| InChIKey | RAZCKLOKDZPMGD-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.38 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|