C17H26NO6P — CID 101429412
ethyl (4R,5S)-3-diethoxyphosphoryl-2-methyl-5-phenyl-1,3-oxazolidine-4-carboxylate (PubChem CID 101429412) has the molecular formula C17H26NO6P and a molecular weight of 371.37 g/mol. Its IUPAC name is ethyl (4R,5S)-3-diethoxyphosphoryl-2-methyl-5-phenyl-1,3-oxazolidine-4-carboxylate.
| Compound Name | ethyl (4R,5S)-3-diethoxyphosphoryl-2-methyl-5-phenyl-1,3-oxazolidine-4-carboxylate |
|---|---|
| PubChem CID | 101429412 |
| Molecular Formula | C17H26NO6P |
| Molecular Weight | 371.37 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | ethyl (4R,5S)-3-diethoxyphosphoryl-2-methyl-5-phenyl-1,3-oxazolidine-4-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@H](c2ccccc2)OC(C)N1P(=O)(OCC)OCC |
| InChI | InChI=1S/C17H26NO6P/c1-5-21-17(19)15-16(14-11-9-8-10-12-14)24-13(4)18(15)25(20,22-6-2)23-7-3/h8-13,15-16H,5-7H2,1-4H3/t13?,15-,16+/m1/s1 |
| InChIKey | LVWFUMGMEYDVRX-CZVYVAOFSA-N |
| XLogP | 3.52 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.37 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|