C24H31NO7 — CID 101456629
4-O,5-O-dimethyl 3-O-[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (4R,5R)-4,5-dihydro-1,2-oxazole-3,4,5-tricarboxylate (PubChem CID 101456629) has the molecular formula C24H31NO7 and a molecular weight of 445.51 g/mol. Its IUPAC name is 4-O,5-O-dimethyl 3-O-[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (4R,5R)-4,5-dihydro-1,2-oxazole-3,4,5-tricarboxylate.
| Compound Name | 4-O,5-O-dimethyl 3-O-[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (4R,5R)-4,5-dihydro-1,2-oxazole-3,4,5-tricarboxylate |
|---|---|
| PubChem CID | 101456629 |
| Molecular Formula | C24H31NO7 |
| Molecular Weight | 445.51 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | 4-O,5-O-dimethyl 3-O-[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (4R,5R)-4,5-dihydro-1,2-oxazole-3,4,5-tricarboxylate |
| SMILES | COC(=O)[C@@H]1C(C(=O)O[C@@H]2C[C@H](C)CC[C@H]2C(C)(C)c2ccccc2)=NO[C@H]1C(=O)OC |
| InChI | InChI=1S/C24H31NO7/c1-14-11-12-16(24(2,3)15-9-7-6-8-10-15)17(13-14)31-22(27)19-18(21(26)29-4)20(32-25-19)23(28)30-5/h6-10,14,16-18,20H,11-13H2,1-5H3/t14-,16-,17-,18-,20-/m1/s1 |
| InChIKey | JMROKGDYESIEQG-JQLJIJSLSA-N |
| XLogP | 3.03 |
| TPSA | 100.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.51 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|