C6H6BrCl5 — CID 102018824
(2R,3S,5S,6R)-1-bromo-2,3,4,5,6-pentachlorocyclohexane (PubChem CID 102018824) has the molecular formula C6H6BrCl5 and a molecular weight of 335.28 g/mol. Its IUPAC name is (2R,3S,5S,6R)-1-bromo-2,3,4,5,6-pentachlorocyclohexane.
| Compound Name | (2R,3S,5S,6R)-1-bromo-2,3,4,5,6-pentachlorocyclohexane |
|---|---|
| PubChem CID | 102018824 |
| Molecular Formula | C6H6BrCl5 |
| Molecular Weight | 335.28 g/mol |
| Exact Mass | 331.81 |
| IUPAC Name | (2R,3S,5S,6R)-1-bromo-2,3,4,5,6-pentachlorocyclohexane |
| SMILES | ClC1[C@H](Cl)[C@@H](Cl)C(Br)[C@H](Cl)[C@H]1Cl |
| InChI | InChI=1S/C6H6BrCl5/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-6H/t1?,2-,3-,4+,5+,6?/m0/s1 |
| InChIKey | YXLJVSSGAVWGFH-WCPZQMMSSA-N |
| XLogP | 3.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.28 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|