C7H10BrCl — CID 131091370
(1R,2S,3R,4S)-2-bromo-3-chlorobicyclo[2.2.1]heptane (PubChem CID 131091370) has the molecular formula C7H10BrCl and a molecular weight of 209.51 g/mol. Its IUPAC name is (1R,2S,3R,4S)-2-bromo-3-chlorobicyclo[2.2.1]heptane.
| Compound Name | (1R,2S,3R,4S)-2-bromo-3-chlorobicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 131091370 |
| Molecular Formula | C7H10BrCl |
| Molecular Weight | 209.51 g/mol |
| Exact Mass | 207.97 |
| IUPAC Name | (1R,2S,3R,4S)-2-bromo-3-chlorobicyclo[2.2.1]heptane |
| SMILES | Cl[C@@H]1[C@H]2CC[C@H](C2)[C@@H]1Br |
| InChI | InChI=1S/C7H10BrCl/c8-6-4-1-2-5(3-4)7(6)9/h4-7H,1-3H2/t4-,5+,6+,7-/m1/s1 |
| InChIKey | MFXKLVIFXLYPMA-JRTVQGFMSA-N |
| XLogP | 2.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.51 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|