C8H10Br2F2 — CID 14387272
(1R,2R,3R,4S)-2-bromo-3-[bromo(difluoro)methyl]bicyclo[2.2.1]heptane (PubChem CID 14387272) has the molecular formula C8H10Br2F2 and a molecular weight of 303.97 g/mol. Its IUPAC name is (1R,2R,3R,4S)-2-bromo-3-[bromo(difluoro)methyl]bicyclo[2.2.1]heptane.
| Compound Name | (1R,2R,3R,4S)-2-bromo-3-[bromo(difluoro)methyl]bicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 14387272 |
| Molecular Formula | C8H10Br2F2 |
| Molecular Weight | 303.97 g/mol |
| Exact Mass | 301.91 |
| IUPAC Name | (1R,2R,3R,4S)-2-bromo-3-[bromo(difluoro)methyl]bicyclo[2.2.1]heptane |
| SMILES | FC(F)(Br)[C@@H]1[C@H]2CC[C@H](C2)[C@H]1Br |
| InChI | InChI=1S/C8H10Br2F2/c9-7-5-2-1-4(3-5)6(7)8(10,11)12/h4-7H,1-3H2/t4-,5+,6+,7+/m0/s1 |
| InChIKey | JHTZRBFWMCITQH-BDVNFPICSA-N |
| XLogP | 3.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.97 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|