C7H10Br2 — CID 102417955
(2S,3S)-2,3-dibromobicyclo[2.2.1]heptane (PubChem CID 102417955) has the molecular formula C7H10Br2 and a molecular weight of 253.96 g/mol. Its IUPAC name is (2S,3S)-2,3-dibromobicyclo[2.2.1]heptane.
| Compound Name | (2S,3S)-2,3-dibromobicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 102417955 |
| Molecular Formula | C7H10Br2 |
| Molecular Weight | 253.96 g/mol |
| Exact Mass | 251.91 |
| IUPAC Name | (2S,3S)-2,3-dibromobicyclo[2.2.1]heptane |
| SMILES | Br[C@H]1C2CCC(C2)[C@@H]1Br |
| InChI | InChI=1S/C7H10Br2/c8-6-4-1-2-5(3-4)7(6)9/h4-7H,1-3H2/t4?,5?,6-,7-/m0/s1 |
| InChIKey | IZDDPSZQOJBKGK-FTDRKVFOSA-N |
| XLogP | 2.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.96 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|