About (2S,3S)-2,3-dibromobicyclo[2.2.1]heptane
(2S,3S)-2,3-dibromobicyclo[2.2.1]heptane (PubChem CID 102417955) has the molecular formula C7H10Br2
and a molecular weight of 253.96 g/mol. Its IUPAC name is (2S,3S)-2,3-dibromobicyclo[2.2.1]heptane.
Molecular Properties
| Compound Name | (2S,3S)-2,3-dibromobicyclo[2.2.1]heptane |
| PubChem CID | 102417955 |
| Molecular Formula | C7H10Br2 |
| Molecular Weight | 253.96 g/mol |
| Exact Mass | 251.91 |
| IUPAC Name | (2S,3S)-2,3-dibromobicyclo[2.2.1]heptane |
| SMILES | Br[C@H]1C2CCC(C2)[C@@H]1Br |
| InChI | InChI=1S/C7H10Br2/c8-6-4-1-2-5(3-4)7(6)9/h4-7H,1-3H2/t4?,5?,6-,7-/m0/s1 |
| InChIKey | IZDDPSZQOJBKGK-FTDRKVFOSA-N |
| XLogP | 2.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.96 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (2S,3S)-2,3-dibromobicyclo[2.2.1]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3S)-2,3-dibromobicyclo[2.2.1]heptane?
The IUPAC name of (2S,3S)-2,3-dibromobicyclo[2.2.1]heptane (CID 102417955) is (2S,3S)-2,3-dibromobicyclo[2.2.1]heptane.
What is the SMILES notation for (2S,3S)-2,3-dibromobicyclo[2.2.1]heptane?
The canonical SMILES for (2S,3S)-2,3-dibromobicyclo[2.2.1]heptane is Br[C@H]1C2CCC(C2)[C@@H]1Br.
What is the InChIKey of (2S,3S)-2,3-dibromobicyclo[2.2.1]heptane?
The InChIKey is IZDDPSZQOJBKGK-FTDRKVFOSA-N. The full InChI is InChI=1S/C7H10Br2/c8-6-4-1-2-5(3-4)7(6)9/h4-7H,1-3H2/t4?,5?,6-,7-/m0/s1.
What are the key properties of (2S,3S)-2,3-dibromobicyclo[2.2.1]heptane?
(2S,3S)-2,3-dibromobicyclo[2.2.1]heptane has a molecular weight of 253.96 g/mol, XLogP of 2.94, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-2,3-dibromobicyclo[2.2.1]heptane is sourced from PubChem (CID 102417955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).