C14H20Br2S — CID 124773964
(1S,2S,3R,4S)-2-bromo-3-[[(1S,2S,3R,4S)-3-bromo-2-bicyclo[2.2.1]heptanyl]sulfanyl]bicyclo[2.2.1]heptane (PubChem CID 124773964) has the molecular formula C14H20Br2S and a molecular weight of 380.19 g/mol. Its IUPAC name is (1S,2S,3R,4S)-2-bromo-3-[[(1S,2S,3R,4S)-3-bromo-2-bicyclo[2.2.1]heptanyl]sulfanyl]bicyclo[2.2.1]heptane.
| Compound Name | (1S,2S,3R,4S)-2-bromo-3-[[(1S,2S,3R,4S)-3-bromo-2-bicyclo[2.2.1]heptanyl]sulfanyl]bicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 124773964 |
| Molecular Formula | C14H20Br2S |
| Molecular Weight | 380.19 g/mol |
| Exact Mass | 377.97 |
| IUPAC Name | (1S,2S,3R,4S)-2-bromo-3-[[(1S,2S,3R,4S)-3-bromo-2-bicyclo[2.2.1]heptanyl]sulfanyl]bicyclo[2.2.1]heptane |
| SMILES | Br[C@@H]1[C@H]2CC[C@@H](C2)[C@@H]1S[C@@H]1[C@H]2CC[C@@H](C2)[C@@H]1Br |
| InChI | InChI=1S/C14H20Br2S/c15-11-7-1-3-9(5-7)13(11)17-14-10-4-2-8(6-10)12(14)16/h7-14H,1-6H2/t7-,8-,9-,10-,11-,12+,13+,14-/m0/s1 |
| InChIKey | SSHGJJMUKDEIMS-ALOZIACYSA-N |
| XLogP | 4.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.19 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|