C7H10BrNO — CID 98513283
(1S,2R,3S,4S)-2-bromo-3-nitrosobicyclo[2.2.1]heptane (PubChem CID 98513283) has the molecular formula C7H10BrNO and a molecular weight of 204.07 g/mol. Its IUPAC name is (1S,2R,3S,4S)-2-bromo-3-nitrosobicyclo[2.2.1]heptane.
| Compound Name | (1S,2R,3S,4S)-2-bromo-3-nitrosobicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 98513283 |
| Molecular Formula | C7H10BrNO |
| Molecular Weight | 204.07 g/mol |
| Exact Mass | 202.99 |
| IUPAC Name | (1S,2R,3S,4S)-2-bromo-3-nitrosobicyclo[2.2.1]heptane |
| SMILES | O=N[C@H]1[C@H]2CC[C@@H](C2)[C@H]1Br |
| InChI | InChI=1S/C7H10BrNO/c8-6-4-1-2-5(3-4)7(6)9-10/h4-7H,1-3H2/t4-,5-,6+,7-/m0/s1 |
| InChIKey | MUSDPFOIXVESSK-YTLHQDLWSA-N |
| XLogP | 2.31 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.07 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|