C10H12BrCl2NO — CID 98571396
(1R,2S,3R,4S,6S,7R,8R,9S)-8-bromo-3,4-dichloro-9-nitrosotricyclo[5.2.1.02,6]decane (PubChem CID 98571396) has the molecular formula C10H12BrCl2NO and a molecular weight of 313.02 g/mol. Its IUPAC name is (1R,2S,3R,4S,6S,7R,8R,9S)-8-bromo-3,4-dichloro-9-nitrosotricyclo[5.2.1.02,6]decane.
| Compound Name | (1R,2S,3R,4S,6S,7R,8R,9S)-8-bromo-3,4-dichloro-9-nitrosotricyclo[5.2.1.02,6]decane |
|---|---|
| PubChem CID | 98571396 |
| Molecular Formula | C10H12BrCl2NO |
| Molecular Weight | 313.02 g/mol |
| Exact Mass | 310.95 |
| IUPAC Name | (1R,2S,3R,4S,6S,7R,8R,9S)-8-bromo-3,4-dichloro-9-nitrosotricyclo[5.2.1.02,6]decane |
| SMILES | O=N[C@@H]1[C@H](Br)[C@@H]2C[C@@H]1[C@H]1[C@@H](Cl)[C@@H](Cl)C[C@H]21 |
| InChI | InChI=1S/C10H12BrCl2NO/c11-8-4-1-5(10(8)14-15)7-3(4)2-6(12)9(7)13/h3-10H,1-2H2/t3-,4-,5-,6+,7+,8-,9+,10+/m1/s1 |
| InChIKey | XTPIJABDTQDDCM-UYXHWWNMSA-N |
| XLogP | 3.39 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.02 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|