C16H30N4O6P2 — CID 102071640
[7-methyl-11-(phosphonomethyl)-3,7,11,17-tetrazabicyclo[11.3.1]heptadeca-1(17),13,15-trien-3-yl]methylphosphonic acid (PubChem CID 102071640) has the molecular formula C16H30N4O6P2 and a molecular weight of 436.39 g/mol. Its IUPAC name is [7-methyl-11-(phosphonomethyl)-3,7,11,17-tetrazabicyclo[11.3.1]heptadeca-1(17),13,15-trien-3-yl]methylphosphonic acid.
| Compound Name | [7-methyl-11-(phosphonomethyl)-3,7,11,17-tetrazabicyclo[11.3.1]heptadeca-1(17),13,15-trien-3-yl]methylphosphonic acid |
|---|---|
| PubChem CID | 102071640 |
| Molecular Formula | C16H30N4O6P2 |
| Molecular Weight | 436.39 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | [7-methyl-11-(phosphonomethyl)-3,7,11,17-tetrazabicyclo[11.3.1]heptadeca-1(17),13,15-trien-3-yl]methylphosphonic acid |
| SMILES | CN1CCCN(CP(=O)(O)O)Cc2cccc(n2)CN(CP(=O)(O)O)CCC1 |
| InChI | InChI=1S/C16H30N4O6P2/c1-18-7-3-9-19(13-27(21,22)23)11-15-5-2-6-16(17-15)12-20(10-4-8-18)14-28(24,25)26/h2,5-6H,3-4,7-14H2,1H3,(H2,21,22,23)(H2,24,25,26) |
| InChIKey | FMFMSFWKVNDRKU-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 137.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.39 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|