C8BF20- — CID 102079519
difluoro-bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)boranuide (PubChem CID 102079519) has the molecular formula C8BF20- and a molecular weight of 486.86 g/mol. Its IUPAC name is difluoro-bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)boranuide.
| Compound Name | difluoro-bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)boranuide |
|---|---|
| PubChem CID | 102079519 |
| Molecular Formula | C8BF20- |
| Molecular Weight | 486.86 g/mol |
| Exact Mass | 486.98 |
| IUPAC Name | difluoro-bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)boranuide |
| SMILES | F[B-](F)(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8BF20/c10-1(11,3(14,15)7(22,23)24)5(18,19)9(28,29)6(20,21)2(12,13)4(16,17)8(25,26)27/q-1 |
| InChIKey | ITDUYSOBBMUXRQ-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.86 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|