C4BF9LiN — CID 89251326
lithium cyano-difluoro-(1,1,2,2,3,3,3-heptafluoropropyl)boranuide (PubChem CID 89251326) has the molecular formula C4BF9LiN and a molecular weight of 250.79 g/mol. Its IUPAC name is lithium cyano-difluoro-(1,1,2,2,3,3,3-heptafluoropropyl)boranuide.
| Compound Name | lithium cyano-difluoro-(1,1,2,2,3,3,3-heptafluoropropyl)boranuide |
|---|---|
| PubChem CID | 89251326 |
| Molecular Formula | C4BF9LiN |
| Molecular Weight | 250.79 g/mol |
| Exact Mass | 251.01 |
| IUPAC Name | lithium cyano-difluoro-(1,1,2,2,3,3,3-heptafluoropropyl)boranuide |
| SMILES | N#C[B-](F)(F)C(F)(F)C(F)(F)C(F)(F)F.[Li+] |
| InChI | InChI=1S/C4BF9N.Li/c6-2(7,4(10,11)12)3(8,9)5(13,14)1-15;/q-1;+1 |
| InChIKey | UCCZPNKRJYYHIE-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.79 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|