C6BF7LiN3 — CID 89251308
lithium tricyano(1,1,2,2,3,3,3-heptafluoropropyl)boranuide (PubChem CID 89251308) has the molecular formula C6BF7LiN3 and a molecular weight of 264.83 g/mol. Its IUPAC name is lithium tricyano(1,1,2,2,3,3,3-heptafluoropropyl)boranuide.
| Compound Name | lithium tricyano(1,1,2,2,3,3,3-heptafluoropropyl)boranuide |
|---|---|
| PubChem CID | 89251308 |
| Molecular Formula | C6BF7LiN3 |
| Molecular Weight | 264.83 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | lithium tricyano(1,1,2,2,3,3,3-heptafluoropropyl)boranuide |
| SMILES | N#C[B-](C#N)(C#N)C(F)(F)C(F)(F)C(F)(F)F.[Li+] |
| InChI | InChI=1S/C6BF7N3.Li/c8-4(9,6(12,13)14)5(10,11)7(1-15,2-16)3-17;/q-1;+1 |
| InChIKey | SNXHYYCMUCMETN-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.83 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|