C33H20Cl4N4O2 — CID 102084795
methyl 5,15-bis(2,6-dichlorophenyl)-22,24-dihydro-21H-corrin-10-carboxylate (PubChem CID 102084795) has the molecular formula C33H20Cl4N4O2 and a molecular weight of 646.36 g/mol. Its IUPAC name is methyl 5,15-bis(2,6-dichlorophenyl)-22,24-dihydro-21H-corrin-10-carboxylate.
| Compound Name | methyl 5,15-bis(2,6-dichlorophenyl)-22,24-dihydro-21H-corrin-10-carboxylate |
|---|---|
| PubChem CID | 102084795 |
| Molecular Formula | C33H20Cl4N4O2 |
| Molecular Weight | 646.36 g/mol |
| Exact Mass | 644.03 |
| IUPAC Name | methyl 5,15-bis(2,6-dichlorophenyl)-22,24-dihydro-21H-corrin-10-carboxylate |
| SMILES | COC(=O)c1c2nc(c(-c3c(Cl)cccc3Cl)c3ccc([nH]3)c3ccc([nH]3)c(-c3c(Cl)cccc3Cl)c3ccc1[nH]3)C=C2 |
| InChI | InChI=1S/C33H20Cl4N4O2/c1-43-33(42)32-26-14-12-24(40-26)30(28-16(34)4-2-5-17(28)35)22-10-8-20(38-22)21-9-11-23(39-21)31(25-13-15-27(32)41-25)29-18(36)6-3-7-19(29)37/h2-15,38-40H,1H3/b21-20-,30-22+,30-24+,31-23+,31-25+,32-26+,32-27+ |
| InChIKey | USVSIUZJWFZBOX-VLBRFMSLSA-N |
| XLogP | 10.43 |
| TPSA | 86.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.36 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |