C15H20Cl3NO3S2 — CID 102087003
N-[(1R,2S)-4,4,4-trichloro-1-cyclohexyl-2-methyl-3-oxobutyl]thiophene-2-sulfonamide (PubChem CID 102087003) has the molecular formula C15H20Cl3NO3S2 and a molecular weight of 432.82 g/mol. Its IUPAC name is N-[(1R,2S)-4,4,4-trichloro-1-cyclohexyl-2-methyl-3-oxobutyl]thiophene-2-sulfonamide.
| Compound Name | N-[(1R,2S)-4,4,4-trichloro-1-cyclohexyl-2-methyl-3-oxobutyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 102087003 |
| Molecular Formula | C15H20Cl3NO3S2 |
| Molecular Weight | 432.82 g/mol |
| Exact Mass | 431.00 |
| IUPAC Name | N-[(1R,2S)-4,4,4-trichloro-1-cyclohexyl-2-methyl-3-oxobutyl]thiophene-2-sulfonamide |
| SMILES | C[C@H](C(=O)C(Cl)(Cl)Cl)[C@H](NS(=O)(=O)c1cccs1)C1CCCCC1 |
| InChI | InChI=1S/C15H20Cl3NO3S2/c1-10(14(20)15(16,17)18)13(11-6-3-2-4-7-11)19-24(21,22)12-8-5-9-23-12/h5,8-11,13,19H,2-4,6-7H2,1H3/t10-,13-/m0/s1 |
| InChIKey | CMEMCBGBQVBJNI-GWCFXTLKSA-N |
| XLogP | 4.55 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.82 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|