C16H15Cl4NO3S2 — CID 134839302
N-[(1S,2S)-4,4,4-trichloro-1-(4-chlorophenyl)-2-ethyl-3-oxobutyl]thiophene-2-sulfonamide (PubChem CID 134839302) has the molecular formula C16H15Cl4NO3S2 and a molecular weight of 475.25 g/mol. Its IUPAC name is N-[(1S,2S)-4,4,4-trichloro-1-(4-chlorophenyl)-2-ethyl-3-oxobutyl]thiophene-2-sulfonamide.
| Compound Name | N-[(1S,2S)-4,4,4-trichloro-1-(4-chlorophenyl)-2-ethyl-3-oxobutyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 134839302 |
| Molecular Formula | C16H15Cl4NO3S2 |
| Molecular Weight | 475.25 g/mol |
| Exact Mass | 472.92 |
| IUPAC Name | N-[(1S,2S)-4,4,4-trichloro-1-(4-chlorophenyl)-2-ethyl-3-oxobutyl]thiophene-2-sulfonamide |
| SMILES | CC[C@H](C(=O)C(Cl)(Cl)Cl)[C@H](NS(=O)(=O)c1cccs1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H15Cl4NO3S2/c1-2-12(15(22)16(18,19)20)14(10-5-7-11(17)8-6-10)21-26(23,24)13-4-3-9-25-13/h3-9,12,14,21H,2H2,1H3/t12-,14+/m0/s1 |
| InChIKey | DEWAXCJWKDIBDW-GXTWGEPZSA-N |
| XLogP | 5.39 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.25 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|