C34H29Br2N3O4 — CID 102098184
ethyl 4-[1,2-bis(4-bromophenyl)-6,6-dimethyl-4-oxo-5,7-dihydroindol-7-yl]-3-oxo-2-phenyl-1H-pyrazole-5-carboxylate (PubChem CID 102098184) has the molecular formula C34H29Br2N3O4 and a molecular weight of 703.43 g/mol. Its IUPAC name is ethyl 4-[1,2-bis(4-bromophenyl)-6,6-dimethyl-4-oxo-5,7-dihydroindol-7-yl]-3-oxo-2-phenyl-1H-pyrazole-5-carboxylate.
| Compound Name | ethyl 4-[1,2-bis(4-bromophenyl)-6,6-dimethyl-4-oxo-5,7-dihydroindol-7-yl]-3-oxo-2-phenyl-1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 102098184 |
| Molecular Formula | C34H29Br2N3O4 |
| Molecular Weight | 703.43 g/mol |
| Exact Mass | 701.05 |
| IUPAC Name | ethyl 4-[1,2-bis(4-bromophenyl)-6,6-dimethyl-4-oxo-5,7-dihydroindol-7-yl]-3-oxo-2-phenyl-1H-pyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1[nH]n(-c2ccccc2)c(=O)c1C1c2c(cc(-c3ccc(Br)cc3)n2-c2ccc(Br)cc2)C(=O)CC1(C)C |
| InChI | InChI=1S/C34H29Br2N3O4/c1-4-43-33(42)30-28(32(41)39(37-30)24-8-6-5-7-9-24)29-31-25(27(40)19-34(29,2)3)18-26(20-10-12-21(35)13-11-20)38(31)23-16-14-22(36)15-17-23/h5-18,29,37H,4,19H2,1-3H3 |
| InChIKey | ILCHQCBWIDZMSB-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.43 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|