C32H51NO3S2Si — CID 102130877
[6-[(1S,3aR,4E,7aR)-4-[2-(1,3-benzothiazol-2-ylsulfonyl)ethylidene]-1,2,3,3a,5,6,7,7a-octahydroinden-1-yl]-2-methylheptan-2-yl]oxy-triethylsilane (PubChem CID 102130877) has the molecular formula C32H51NO3S2Si and a molecular weight of 589.98 g/mol. Its IUPAC name is [6-[(1S,3aR,4E,7aR)-4-[2-(1,3-benzothiazol-2-ylsulfonyl)ethylidene]-1,2,3,3a,5,6,7,7a-octahydroinden-1-yl]-2-methylheptan-2-yl]oxy-triethylsilane.
| Compound Name | [6-[(1S,3aR,4E,7aR)-4-[2-(1,3-benzothiazol-2-ylsulfonyl)ethylidene]-1,2,3,3a,5,6,7,7a-octahydroinden-1-yl]-2-methylheptan-2-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 102130877 |
| Molecular Formula | C32H51NO3S2Si |
| Molecular Weight | 589.98 g/mol |
| Exact Mass | 589.31 |
| IUPAC Name | [6-[(1S,3aR,4E,7aR)-4-[2-(1,3-benzothiazol-2-ylsulfonyl)ethylidene]-1,2,3,3a,5,6,7,7a-octahydroinden-1-yl]-2-methylheptan-2-yl]oxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)OC(C)(C)CCCC(C)[C@@H]1CC[C@H]2/C(=C/CS(=O)(=O)c3nc4ccccc4s3)CCC[C@@H]21 |
| InChI | InChI=1S/C32H51NO3S2Si/c1-7-39(8-2,9-3)36-32(5,6)22-13-14-24(4)26-19-20-27-25(15-12-16-28(26)27)21-23-38(34,35)31-33-29-17-10-11-18-30(29)37-31/h10-11,17-18,21,24,26-28H,7-9,12-16,19-20,22-23H2,1-6H3/b25-21+/t24?,26-,27-,28+/m0/s1 |
| InChIKey | QNKYHJPOQVBMAB-YDXLUEQXSA-N |
| XLogP | 9.43 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.98 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|