C51H23F15N4O8 — CID 102135517
tetramethyl 5-[5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-23,24-dihydro-21H-corrin-3-yl]benzene-1,2,3,4-tetracarboxylate (PubChem CID 102135517) has the molecular formula C51H23F15N4O8 and a molecular weight of 1104.73 g/mol. Its IUPAC name is tetramethyl 5-[5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-23,24-dihydro-21H-corrin-3-yl]benzene-1,2,3,4-tetracarboxylate.
| Compound Name | tetramethyl 5-[5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-23,24-dihydro-21H-corrin-3-yl]benzene-1,2,3,4-tetracarboxylate |
|---|---|
| PubChem CID | 102135517 |
| Molecular Formula | C51H23F15N4O8 |
| Molecular Weight | 1104.73 g/mol |
| Exact Mass | 1104.13 |
| IUPAC Name | tetramethyl 5-[5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-23,24-dihydro-21H-corrin-3-yl]benzene-1,2,3,4-tetracarboxylate |
| SMILES | COC(=O)c1cc(-c2cc3[nH]c2c(-c2c(F)c(F)c(F)c(F)c2F)c2nc(c(-c4c(F)c(F)c(F)c(F)c4F)c4ccc([nH]4)c(-c4c(F)c(F)c(F)c(F)c4F)c4ccc3[nH]4)C=C2)c(C(=O)OC)c(C(=O)OC)c1C(=O)OC |
| InChI | InChI=1S/C51H23F15N4O8/c1-75-48(71)15-11-13(23(49(72)76-2)28(51(74)78-4)24(15)50(73)77-3)14-12-22-16-5-6-17(67-16)25(29-32(52)38(58)44(64)39(59)33(29)53)18-7-8-19(68-18)26(30-34(54)40(60)45(65)41(61)35(30)55)20-9-10-21(69-20)27(47(14)70-22)31-36(56)42(62)46(66)43(63)37(31)57/h5-12,67-68,70H,1-4H3/b22-16-,25-17+,25-18+,26-19+,26-20+,27-21-,47-27+ |
| InChIKey | ZDVHAFZPUZRVJQ-WYGYLXGSSA-N |
| XLogP | 12.60 |
| TPSA | 165.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1104.73 |
| LogP ≤ 5 | 12.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|