C14H21NO3 — CID 102158067
2-[(3S,5S,6S)-4,5-dimethyl-4-oxido-6-phenylmorpholin-4-ium-3-yl]ethanol (PubChem CID 102158067) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is 2-[(3S,5S,6S)-4,5-dimethyl-4-oxido-6-phenylmorpholin-4-ium-3-yl]ethanol.
| Compound Name | 2-[(3S,5S,6S)-4,5-dimethyl-4-oxido-6-phenylmorpholin-4-ium-3-yl]ethanol |
|---|---|
| PubChem CID | 102158067 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 2-[(3S,5S,6S)-4,5-dimethyl-4-oxido-6-phenylmorpholin-4-ium-3-yl]ethanol |
| SMILES | C[C@H]1[C@H](c2ccccc2)OC[C@H](CCO)[N+]1(C)[O-] |
| InChI | InChI=1S/C14H21NO3/c1-11-14(12-6-4-3-5-7-12)18-10-13(8-9-16)15(11,2)17/h3-7,11,13-14,16H,8-10H2,1-2H3/t11-,13-,14+,15?/m0/s1 |
| InChIKey | FXLBMLBMSXVFJV-YXQSOJMXSA-N |
| XLogP | 1.84 |
| TPSA | 52.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|