C11H10N2O4 — CID 102169767
2-[(3S,4S)-4-hydroxy-6-nitro-3,4-dihydro-2H-chromen-3-yl]acetonitrile (PubChem CID 102169767) has the molecular formula C11H10N2O4 and a molecular weight of 234.21 g/mol. Its IUPAC name is 2-[(3S,4S)-4-hydroxy-6-nitro-3,4-dihydro-2H-chromen-3-yl]acetonitrile.
| Compound Name | 2-[(3S,4S)-4-hydroxy-6-nitro-3,4-dihydro-2H-chromen-3-yl]acetonitrile |
|---|---|
| PubChem CID | 102169767 |
| Molecular Formula | C11H10N2O4 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 2-[(3S,4S)-4-hydroxy-6-nitro-3,4-dihydro-2H-chromen-3-yl]acetonitrile |
| SMILES | N#CC[C@H]1COc2ccc([N+](=O)[O-])cc2[C@H]1O |
| InChI | InChI=1S/C11H10N2O4/c12-4-3-7-6-17-10-2-1-8(13(15)16)5-9(10)11(7)14/h1-2,5,7,11,14H,3,6H2/t7-,11-/m0/s1 |
| InChIKey | HONUTGMGMVJWLQ-CPCISQLKSA-N |
| XLogP | 1.55 |
| TPSA | 96.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|