C25H23ClN6O2 — CID 10217371
2-[(3-amino-1,2-benzoxazol-5-yl)amino]-N-[3-chloro-4-(2-iminopyrrolidin-1-yl)phenyl]-2-phenylacetamide (PubChem CID 10217371) has the molecular formula C25H23ClN6O2 and a molecular weight of 474.95 g/mol. Its IUPAC name is 2-[(3-amino-1,2-benzoxazol-5-yl)amino]-N-[3-chloro-4-(2-iminopyrrolidin-1-yl)phenyl]-2-phenylacetamide.
| Compound Name | 2-[(3-amino-1,2-benzoxazol-5-yl)amino]-N-[3-chloro-4-(2-iminopyrrolidin-1-yl)phenyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 10217371 |
| Molecular Formula | C25H23ClN6O2 |
| Molecular Weight | 474.95 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | 2-[(3-amino-1,2-benzoxazol-5-yl)amino]-N-[3-chloro-4-(2-iminopyrrolidin-1-yl)phenyl]-2-phenylacetamide |
| SMILES | [H]/N=C1\CCCN1c1ccc(NC(=O)C(Nc2ccc3onc(N)c3c2)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C25H23ClN6O2/c26-19-14-17(8-10-20(19)32-12-4-7-22(32)27)30-25(33)23(15-5-2-1-3-6-15)29-16-9-11-21-18(13-16)24(28)31-34-21/h1-3,5-6,8-11,13-14,23,27,29H,4,7,12H2,(H2,28,31)(H,30,33)/b27-22+ |
| InChIKey | MGDAVKBTKRTHRG-HPNDGRJYSA-N |
| XLogP | 5.43 |
| TPSA | 120.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.95 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|