C25H38O5Si — CID 102233428
(5S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-1-[(2E,4E)-4,6-dimethylocta-2,4-dienoyl]-5-hydroxy-5-methyl-6,7-dihydro-2-benzofuran-4-one (PubChem CID 102233428) has the molecular formula C25H38O5Si and a molecular weight of 446.66 g/mol. Its IUPAC name is (5S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-1-[(2E,4E)-4,6-dimethylocta-2,4-dienoyl]-5-hydroxy-5-methyl-6,7-dihydro-2-benzofuran-4-one.
| Compound Name | (5S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-1-[(2E,4E)-4,6-dimethylocta-2,4-dienoyl]-5-hydroxy-5-methyl-6,7-dihydro-2-benzofuran-4-one |
|---|---|
| PubChem CID | 102233428 |
| Molecular Formula | C25H38O5Si |
| Molecular Weight | 446.66 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | (5S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-1-[(2E,4E)-4,6-dimethylocta-2,4-dienoyl]-5-hydroxy-5-methyl-6,7-dihydro-2-benzofuran-4-one |
| SMILES | CCC(C)/C=C(C)/C=C/C(=O)c1occ2c1C[C@@H](O[Si](C)(C)C(C)(C)C)[C@](C)(O)C2=O |
| InChI | InChI=1S/C25H38O5Si/c1-10-16(2)13-17(3)11-12-20(26)22-18-14-21(30-31(8,9)24(4,5)6)25(7,28)23(27)19(18)15-29-22/h11-13,15-16,21,28H,10,14H2,1-9H3/b12-11+,17-13+/t16?,21-,25+/m1/s1 |
| InChIKey | RAHCCDQDHSIYFM-RITDQAGYSA-N |
| XLogP | 5.89 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.66 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|