C36H59NO7Si — CID 102530054
(2E,4E,6E,8R,10R)-1-[5-[4-[tert-butyl(dimethyl)silyl]oxy-1-hydroxycyclohexyl]-2,4-bis(methoxymethoxy)-3-pyridinyl]-6,8,10-trimethyldodeca-2,4,6-trien-1-one (PubChem CID 102530054) has the molecular formula C36H59NO7Si and a molecular weight of 645.95 g/mol. Its IUPAC name is (2E,4E,6E,8R,10R)-1-[5-[4-[tert-butyl(dimethyl)silyl]oxy-1-hydroxycyclohexyl]-2,4-bis(methoxymethoxy)-3-pyridinyl]-6,8,10-trimethyldodeca-2,4,6-trien-1-one.
| Compound Name | (2E,4E,6E,8R,10R)-1-[5-[4-[tert-butyl(dimethyl)silyl]oxy-1-hydroxycyclohexyl]-2,4-bis(methoxymethoxy)-3-pyridinyl]-6,8,10-trimethyldodeca-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 102530054 |
| Molecular Formula | C36H59NO7Si |
| Molecular Weight | 645.95 g/mol |
| Exact Mass | 645.41 |
| IUPAC Name | (2E,4E,6E,8R,10R)-1-[5-[4-[tert-butyl(dimethyl)silyl]oxy-1-hydroxycyclohexyl]-2,4-bis(methoxymethoxy)-3-pyridinyl]-6,8,10-trimethyldodeca-2,4,6-trien-1-one |
| SMILES | CC[C@@H](C)C[C@@H](C)/C=C(C)/C=C/C=C/C(=O)c1c(OCOC)ncc(C2(O)CCC(O[Si](C)(C)C(C)(C)C)CC2)c1OCOC |
| InChI | InChI=1S/C36H59NO7Si/c1-12-26(2)21-28(4)22-27(3)15-13-14-16-31(38)32-33(42-24-40-8)30(23-37-34(32)43-25-41-9)36(39)19-17-29(18-20-36)44-45(10,11)35(5,6)7/h13-16,22-23,26,28-29,39H,12,17-21,24-25H2,1-11H3/b15-13+,16-14+,27-22+/t26-,28-,29?,36?/m1/s1 |
| InChIKey | KLKPUYIMGLPMLF-BQZWPASQSA-N |
| XLogP | 8.51 |
| TPSA | 96.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.95 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|