C22H23IO2 — CID 102261142
1-[[(1R,2R)-4-iodo-3-phenyl-2-prop-1-en-2-ylcyclopent-3-en-1-yl]oxymethyl]-4-methoxybenzene (PubChem CID 102261142) has the molecular formula C22H23IO2 and a molecular weight of 446.33 g/mol. Its IUPAC name is 1-[[(1R,2R)-4-iodo-3-phenyl-2-prop-1-en-2-ylcyclopent-3-en-1-yl]oxymethyl]-4-methoxybenzene.
| Compound Name | 1-[[(1R,2R)-4-iodo-3-phenyl-2-prop-1-en-2-ylcyclopent-3-en-1-yl]oxymethyl]-4-methoxybenzene |
|---|---|
| PubChem CID | 102261142 |
| Molecular Formula | C22H23IO2 |
| Molecular Weight | 446.33 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | 1-[[(1R,2R)-4-iodo-3-phenyl-2-prop-1-en-2-ylcyclopent-3-en-1-yl]oxymethyl]-4-methoxybenzene |
| SMILES | C=C(C)[C@@H]1C(c2ccccc2)=C(I)C[C@H]1OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C22H23IO2/c1-15(2)21-20(25-14-16-9-11-18(24-3)12-10-16)13-19(23)22(21)17-7-5-4-6-8-17/h4-12,20-21H,1,13-14H2,2-3H3/t20-,21+/m1/s1 |
| InChIKey | BUTGKUGYHCGAEO-RTWAWAEBSA-N |
| XLogP | 6.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.33 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|