C32H39N6O12P — CID 102329021
methyl (2S,3R)-3-[[(2R,3S,5R)-3-acetyloxy-5-[6-[(2-phenylacetyl)amino]purin-9-yl]oxolan-2-yl]methoxy-prop-2-enoxyphosphoryl]oxy-2-(prop-2-enoxycarbonylamino)butanoate (PubChem CID 102329021) has the molecular formula C32H39N6O12P and a molecular weight of 730.67 g/mol. Its IUPAC name is methyl (2S,3R)-3-[[(2R,3S,5R)-3-acetyloxy-5-[6-[(2-phenylacetyl)amino]purin-9-yl]oxolan-2-yl]methoxy-prop-2-enoxyphosphoryl]oxy-2-(prop-2-enoxycarbonylamino)butanoate.
| Compound Name | methyl (2S,3R)-3-[[(2R,3S,5R)-3-acetyloxy-5-[6-[(2-phenylacetyl)amino]purin-9-yl]oxolan-2-yl]methoxy-prop-2-enoxyphosphoryl]oxy-2-(prop-2-enoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 102329021 |
| Molecular Formula | C32H39N6O12P |
| Molecular Weight | 730.67 g/mol |
| Exact Mass | 730.24 |
| IUPAC Name | methyl (2S,3R)-3-[[(2R,3S,5R)-3-acetyloxy-5-[6-[(2-phenylacetyl)amino]purin-9-yl]oxolan-2-yl]methoxy-prop-2-enoxyphosphoryl]oxy-2-(prop-2-enoxycarbonylamino)butanoate |
| SMILES | C=CCOC(=O)N[C@H](C(=O)OC)[C@@H](C)OP(=O)(OCC=C)OC[C@H]1O[C@@H](n2cnc3c(NC(=O)Cc4ccccc4)ncnc32)C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C32H39N6O12P/c1-6-13-45-32(42)37-27(31(41)44-5)20(3)50-51(43,46-14-7-2)47-17-24-23(48-21(4)39)16-26(49-24)38-19-35-28-29(33-18-34-30(28)38)36-25(40)15-22-11-9-8-10-12-22/h6-12,18-20,23-24,26-27H,1-2,13-17H2,3-5H3,(H,37,42)(H,33,34,36,40)/t20-,23+,24-,26-,27+,51?/m1/s1 |
| InChIKey | WLAMXIPOSMJIIE-YVHAUSTISA-N |
| XLogP | 3.41 |
| TPSA | 217.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.67 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|