About 3,5-diphenyl-1,2,4-triselenolane
3,5-diphenyl-1,2,4-triselenolane (PubChem CID 102357069) has the molecular formula C14H12Se3
and a molecular weight of 417.13 g/mol. Its IUPAC name is 3,5-diphenyl-1,2,4-triselenolane.
Molecular Properties
| Compound Name | 3,5-diphenyl-1,2,4-triselenolane |
| PubChem CID | 102357069 |
| Molecular Formula | C14H12Se3 |
| Molecular Weight | 417.13 g/mol |
| Exact Mass | 419.84 |
| IUPAC Name | 3,5-diphenyl-1,2,4-triselenolane |
| SMILES | c1ccc(C2[Se][Se]C(c3ccccc3)[Se]2)cc1 |
| InChI | InChI=1S/C14H12Se3/c1-3-7-11(8-4-1)13-15-14(17-16-13)12-9-5-2-6-10-12/h1-10,13-14H |
| InChIKey | CTEAKTMLUZJDSC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.13 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3,5-diphenyl-1,2,4-triselenolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-diphenyl-1,2,4-triselenolane?
The IUPAC name of 3,5-diphenyl-1,2,4-triselenolane (CID 102357069) is 3,5-diphenyl-1,2,4-triselenolane.
What is the SMILES notation for 3,5-diphenyl-1,2,4-triselenolane?
The canonical SMILES for 3,5-diphenyl-1,2,4-triselenolane is c1ccc(C2[Se][Se]C(c3ccccc3)[Se]2)cc1.
What is the InChIKey of 3,5-diphenyl-1,2,4-triselenolane?
The InChIKey is CTEAKTMLUZJDSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12Se3/c1-3-7-11(8-4-1)13-15-14(17-16-13)12-9-5-2-6-10-12/h1-10,13-14H.
What are the key properties of 3,5-diphenyl-1,2,4-triselenolane?
3,5-diphenyl-1,2,4-triselenolane has a molecular weight of 417.13 g/mol, XLogP of 2.43, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diphenyl-1,2,4-triselenolane is sourced from PubChem (CID 102357069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).