C14H12Se3 — CID 102357069
3,5-diphenyl-1,2,4-triselenolane (PubChem CID 102357069) has the molecular formula C14H12Se3 and a molecular weight of 417.13 g/mol. Its IUPAC name is 3,5-diphenyl-1,2,4-triselenolane.
| Compound Name | 3,5-diphenyl-1,2,4-triselenolane |
|---|---|
| PubChem CID | 102357069 |
| Molecular Formula | C14H12Se3 |
| Molecular Weight | 417.13 g/mol |
| Exact Mass | 419.84 |
| IUPAC Name | 3,5-diphenyl-1,2,4-triselenolane |
| SMILES | c1ccc(C2[Se][Se]C(c3ccccc3)[Se]2)cc1 |
| InChI | InChI=1S/C14H12Se3/c1-3-7-11(8-4-1)13-15-14(17-16-13)12-9-5-2-6-10-12/h1-10,13-14H |
| InChIKey | CTEAKTMLUZJDSC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.13 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|