C13H19N5O4 — CID 102366653
tert-butyl N-(6-methoxy-7,9-dimethyl-8-oxopurin-2-yl)carbamate (PubChem CID 102366653) has the molecular formula C13H19N5O4 and a molecular weight of 309.33 g/mol. Its IUPAC name is tert-butyl N-(6-methoxy-7,9-dimethyl-8-oxopurin-2-yl)carbamate.
| Compound Name | tert-butyl N-(6-methoxy-7,9-dimethyl-8-oxopurin-2-yl)carbamate |
|---|---|
| PubChem CID | 102366653 |
| Molecular Formula | C13H19N5O4 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | tert-butyl N-(6-methoxy-7,9-dimethyl-8-oxopurin-2-yl)carbamate |
| SMILES | COc1nc(NC(=O)OC(C)(C)C)nc2c1n(C)c(=O)n2C |
| InChI | InChI=1S/C13H19N5O4/c1-13(2,3)22-11(19)16-10-14-8-7(9(15-10)21-6)17(4)12(20)18(8)5/h1-6H3,(H,14,15,16,19) |
| InChIKey | QXEDUBUUFHAXEN-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |