C38H56FN7 — CID 102387142
1-(3-fluoro-1,4,5,6,7,8-hexapyrrolidin-1-ylnaphthalen-2-yl)pyrrolidine (PubChem CID 102387142) has the molecular formula C38H56FN7 and a molecular weight of 629.91 g/mol. Its IUPAC name is 1-(3-fluoro-1,4,5,6,7,8-hexapyrrolidin-1-ylnaphthalen-2-yl)pyrrolidine.
| Compound Name | 1-(3-fluoro-1,4,5,6,7,8-hexapyrrolidin-1-ylnaphthalen-2-yl)pyrrolidine |
|---|---|
| PubChem CID | 102387142 |
| Molecular Formula | C38H56FN7 |
| Molecular Weight | 629.91 g/mol |
| Exact Mass | 629.46 |
| IUPAC Name | 1-(3-fluoro-1,4,5,6,7,8-hexapyrrolidin-1-ylnaphthalen-2-yl)pyrrolidine |
| SMILES | Fc1c(N2CCCC2)c(N2CCCC2)c2c(N3CCCC3)c(N3CCCC3)c(N3CCCC3)c(N3CCCC3)c2c1N1CCCC1 |
| InChI | InChI=1S/C38H56FN7/c39-31-32(40-15-1-2-16-40)29-30(33(41-17-3-4-18-41)36(31)44-23-9-10-24-44)35(43-21-7-8-22-43)38(46-27-13-14-28-46)37(45-25-11-12-26-45)34(29)42-19-5-6-20-42/h1-28H2 |
| InChIKey | DRYUGQRKGAJGPS-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 22.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.91 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |