C20H23NO8 — CID 102437181
tetramethyl 6,8,9a-trimethylquinolizine-1,2,3,4-tetracarboxylate (PubChem CID 102437181) has the molecular formula C20H23NO8 and a molecular weight of 405.40 g/mol. Its IUPAC name is tetramethyl 6,8,9a-trimethylquinolizine-1,2,3,4-tetracarboxylate.
| Compound Name | tetramethyl 6,8,9a-trimethylquinolizine-1,2,3,4-tetracarboxylate |
|---|---|
| PubChem CID | 102437181 |
| Molecular Formula | C20H23NO8 |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | tetramethyl 6,8,9a-trimethylquinolizine-1,2,3,4-tetracarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N2C(C)=CC(C)=CC2(C)C(C(=O)OC)=C1C(=O)OC |
| InChI | InChI=1S/C20H23NO8/c1-10-8-11(2)21-15(19(25)29-7)13(17(23)27-5)12(16(22)26-4)14(18(24)28-6)20(21,3)9-10/h8-9H,1-7H3 |
| InChIKey | JIYFVHVTMKERTP-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|