C19H19NO8 — CID 7314354
tetramethyl (9aS)-9a-ethenylquinolizine-1,2,3,4-tetracarboxylate (PubChem CID 7314354) has the molecular formula C19H19NO8 and a molecular weight of 389.36 g/mol. Its IUPAC name is tetramethyl (9aS)-9a-ethenylquinolizine-1,2,3,4-tetracarboxylate.
| Compound Name | tetramethyl (9aS)-9a-ethenylquinolizine-1,2,3,4-tetracarboxylate |
|---|---|
| PubChem CID | 7314354 |
| Molecular Formula | C19H19NO8 |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | tetramethyl (9aS)-9a-ethenylquinolizine-1,2,3,4-tetracarboxylate |
| SMILES | C=C[C@@]12C=CC=CN1C(C(=O)OC)=C(C(=O)OC)C(C(=O)OC)=C2C(=O)OC |
| InChI | InChI=1S/C19H19NO8/c1-6-19-9-7-8-10-20(19)14(18(24)28-5)12(16(22)26-3)11(15(21)25-2)13(19)17(23)27-4/h6-10H,1H2,2-5H3/t19-/m0/s1 |
| InChIKey | ICAOSGOAKOHEDF-IBGZPJMESA-N |
| XLogP | 0.55 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|