C24H22O6 — CID 102470148
[(3R,4S)-11-methoxy-3-methyl-1,7,12-trioxo-3,4-dihydro-2H-benzo[a]anthracen-4-yl] 2-methylpropanoate (PubChem CID 102470148) has the molecular formula C24H22O6 and a molecular weight of 406.43 g/mol. Its IUPAC name is [(3R,4S)-11-methoxy-3-methyl-1,7,12-trioxo-3,4-dihydro-2H-benzo[a]anthracen-4-yl] 2-methylpropanoate.
| Compound Name | [(3R,4S)-11-methoxy-3-methyl-1,7,12-trioxo-3,4-dihydro-2H-benzo[a]anthracen-4-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 102470148 |
| Molecular Formula | C24H22O6 |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | [(3R,4S)-11-methoxy-3-methyl-1,7,12-trioxo-3,4-dihydro-2H-benzo[a]anthracen-4-yl] 2-methylpropanoate |
| SMILES | COc1cccc2c1C(=O)c1c(ccc3c1C(=O)C[C@@H](C)[C@@H]3OC(=O)C(C)C)C2=O |
| InChI | InChI=1S/C24H22O6/c1-11(2)24(28)30-23-12(3)10-16(25)18-15(23)9-8-14-20(18)22(27)19-13(21(14)26)6-5-7-17(19)29-4/h5-9,11-12,23H,10H2,1-4H3/t12-,23+/m1/s1 |
| InChIKey | PVABVPLESOVDQY-SPSFWMDKSA-N |
| XLogP | 3.93 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|