C6H6Cl2O2 — CID 102473749
(1S,4S)-2,5-dichlorocyclohexa-2,5-diene-1,4-diol (PubChem CID 102473749) has the molecular formula C6H6Cl2O2 and a molecular weight of 181.02 g/mol. Its IUPAC name is (1S,4S)-2,5-dichlorocyclohexa-2,5-diene-1,4-diol.
| Compound Name | (1S,4S)-2,5-dichlorocyclohexa-2,5-diene-1,4-diol |
|---|---|
| PubChem CID | 102473749 |
| Molecular Formula | C6H6Cl2O2 |
| Molecular Weight | 181.02 g/mol |
| Exact Mass | 179.97 |
| IUPAC Name | (1S,4S)-2,5-dichlorocyclohexa-2,5-diene-1,4-diol |
| SMILES | O[C@H]1C=C(Cl)[C@@H](O)C=C1Cl |
| InChI | InChI=1S/C6H6Cl2O2/c7-3-1-5(9)4(8)2-6(3)10/h1-2,5-6,9-10H/t5-,6-/m0/s1 |
| InChIKey | CPXFTNFOQXXRBF-WDSKDSINSA-N |
| XLogP | 0.97 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.02 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |