C6H7ClO — CID 71662884
(1S)-3-chlorocyclohexa-2,4-dien-1-ol (PubChem CID 71662884) has the molecular formula C6H7ClO and a molecular weight of 130.57 g/mol. Its IUPAC name is (1S)-3-chlorocyclohexa-2,4-dien-1-ol.
| Compound Name | (1S)-3-chlorocyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 71662884 |
| Molecular Formula | C6H7ClO |
| Molecular Weight | 130.57 g/mol |
| Exact Mass | 130.02 |
| IUPAC Name | (1S)-3-chlorocyclohexa-2,4-dien-1-ol |
| SMILES | O[C@@H]1C=C(Cl)C=CC1 |
| InChI | InChI=1S/C6H7ClO/c7-5-2-1-3-6(8)4-5/h1-2,4,6,8H,3H2/t6-/m0/s1 |
| InChIKey | PEXJWSRIBBMDFG-LURJTMIESA-N |
| XLogP | 1.43 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.57 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |