C10H11ClO — CID 130129391
3-chloro-1,2,8,8a-tetrahydroazulen-2-ol (PubChem CID 130129391) has the molecular formula C10H11ClO and a molecular weight of 182.65 g/mol. Its IUPAC name is 3-chloro-1,2,8,8a-tetrahydroazulen-2-ol.
| Compound Name | 3-chloro-1,2,8,8a-tetrahydroazulen-2-ol |
|---|---|
| PubChem CID | 130129391 |
| Molecular Formula | C10H11ClO |
| Molecular Weight | 182.65 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | 3-chloro-1,2,8,8a-tetrahydroazulen-2-ol |
| SMILES | OC1CC2CC=CC=CC2=C1Cl |
| InChI | InChI=1S/C10H11ClO/c11-10-8-5-3-1-2-4-7(8)6-9(10)12/h1-3,5,7,9,12H,4,6H2 |
| InChIKey | OLHXRXCNVYXVLP-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.65 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |