C28H40O6 — CID 10254228
[(1R,2R,3S,5R)-3-(1-ethoxyethoxy)-5-(1-ethoxyethoxymethyl)-2-phenylmethoxycyclopentyl]oxymethylbenzene (PubChem CID 10254228) has the molecular formula C28H40O6 and a molecular weight of 472.62 g/mol. Its IUPAC name is [(1R,2R,3S,5R)-3-(1-ethoxyethoxy)-5-(1-ethoxyethoxymethyl)-2-phenylmethoxycyclopentyl]oxymethylbenzene.
| Compound Name | [(1R,2R,3S,5R)-3-(1-ethoxyethoxy)-5-(1-ethoxyethoxymethyl)-2-phenylmethoxycyclopentyl]oxymethylbenzene |
|---|---|
| PubChem CID | 10254228 |
| Molecular Formula | C28H40O6 |
| Molecular Weight | 472.62 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | [(1R,2R,3S,5R)-3-(1-ethoxyethoxy)-5-(1-ethoxyethoxymethyl)-2-phenylmethoxycyclopentyl]oxymethylbenzene |
| SMILES | CCOC(C)OC[C@H]1C[C@H](OC(C)OCC)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C28H40O6/c1-5-29-21(3)31-20-25-17-26(34-22(4)30-6-2)28(33-19-24-15-11-8-12-16-24)27(25)32-18-23-13-9-7-10-14-23/h7-16,21-22,25-28H,5-6,17-20H2,1-4H3/t21?,22?,25-,26+,27-,28-/m1/s1 |
| InChIKey | VXKKTBSQEDTCAM-FPYDKWNKSA-N |
| XLogP | 5.34 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.62 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|