C28H39NO8 — CID 10029565
[(1R,2R,4S,5S)-4-(1-ethoxyethoxy)-2-(1-ethoxyethoxymethyl)-3-nitro-5-phenylmethoxycyclopentyl]oxymethylbenzene (PubChem CID 10029565) has the molecular formula C28H39NO8 and a molecular weight of 517.62 g/mol. Its IUPAC name is [(1R,2R,4S,5S)-4-(1-ethoxyethoxy)-2-(1-ethoxyethoxymethyl)-3-nitro-5-phenylmethoxycyclopentyl]oxymethylbenzene.
| Compound Name | [(1R,2R,4S,5S)-4-(1-ethoxyethoxy)-2-(1-ethoxyethoxymethyl)-3-nitro-5-phenylmethoxycyclopentyl]oxymethylbenzene |
|---|---|
| PubChem CID | 10029565 |
| Molecular Formula | C28H39NO8 |
| Molecular Weight | 517.62 g/mol |
| Exact Mass | 517.27 |
| IUPAC Name | [(1R,2R,4S,5S)-4-(1-ethoxyethoxy)-2-(1-ethoxyethoxymethyl)-3-nitro-5-phenylmethoxycyclopentyl]oxymethylbenzene |
| SMILES | CCOC(C)OC[C@H]1C([N+](=O)[O-])[C@H](OC(C)OCC)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C28H39NO8/c1-5-32-20(3)34-19-24-25(29(30)31)27(37-21(4)33-6-2)28(36-18-23-15-11-8-12-16-23)26(24)35-17-22-13-9-7-10-14-22/h7-16,20-21,24-28H,5-6,17-19H2,1-4H3/t20?,21?,24-,25?,26+,27-,28-/m0/s1 |
| InChIKey | MBZDJEFYXOGHKI-SBOFCNMWSA-N |
| XLogP | 4.60 |
| TPSA | 98.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.62 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|