C26H30O2 — CID 102573654
1-(2-hydroxy-3-prop-2-enyl-5,6,7,8-tetrahydronaphthalen-1-yl)-3-prop-2-enyl-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 102573654) has the molecular formula C26H30O2 and a molecular weight of 374.52 g/mol. Its IUPAC name is 1-(2-hydroxy-3-prop-2-enyl-5,6,7,8-tetrahydronaphthalen-1-yl)-3-prop-2-enyl-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | 1-(2-hydroxy-3-prop-2-enyl-5,6,7,8-tetrahydronaphthalen-1-yl)-3-prop-2-enyl-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 102573654 |
| Molecular Formula | C26H30O2 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | 1-(2-hydroxy-3-prop-2-enyl-5,6,7,8-tetrahydronaphthalen-1-yl)-3-prop-2-enyl-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | C=CCc1cc2c(c(-c3c(O)c(CC=C)cc4c3CCCC4)c1O)CCCC2 |
| InChI | InChI=1S/C26H30O2/c1-3-9-19-15-17-11-5-7-13-21(17)23(25(19)27)24-22-14-8-6-12-18(22)16-20(10-4-2)26(24)28/h3-4,15-16,27-28H,1-2,5-14H2 |
| InChIKey | YHHXUVONTRJNSR-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|